C25H23NO3 — CID 71032597
6-[(Z)-(13-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,14-pentaenylidene)methyl]-8-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 71032597) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 6-[(Z)-(13-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,14-pentaenylidene)methyl]-8-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(Z)-(13-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,14-pentaenylidene)methyl]-8-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 71032597 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 6-[(Z)-(13-hydroxy-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,14-pentaenylidene)methyl]-8-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cc(/C=C2/C3=C(CCc4ccccc42)CC(O)C=C3)cc2c1OCC(=O)N2 |
| InChI | InChI=1S/C25H23NO3/c1-15-10-16(12-23-25(15)29-14-24(28)26-23)11-22-20-5-3-2-4-17(20)6-7-18-13-19(27)8-9-21(18)22/h2-5,8-12,19,27H,6-7,13-14H2,1H3,(H,26,28)/b22-11+ |
| InChIKey | XUTBFPWBUJTGHW-SSDVNMTOSA-N |
| XLogP | 4.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|