C28H31NO5 — CID 71032773
(1S,2R,6S)-4-(2,6-diethyl-4-methylphenyl)-5-hydroxy-2,6-dimethyl-8-(2-nitrophenyl)-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one (PubChem CID 71032773) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is (1S,2R,6S)-4-(2,6-diethyl-4-methylphenyl)-5-hydroxy-2,6-dimethyl-8-(2-nitrophenyl)-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one.
| Compound Name | (1S,2R,6S)-4-(2,6-diethyl-4-methylphenyl)-5-hydroxy-2,6-dimethyl-8-(2-nitrophenyl)-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one |
|---|---|
| PubChem CID | 71032773 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (1S,2R,6S)-4-(2,6-diethyl-4-methylphenyl)-5-hydroxy-2,6-dimethyl-8-(2-nitrophenyl)-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one |
| SMILES | CCc1cc(C)cc(CC)c1C1=C(O)[C@]2(C)C3O[C@@H](CC3c3ccccc3[N+](=O)[O-])[C@]2(C)C1=O |
| InChI | InChI=1S/C28H31NO5/c1-6-16-12-15(3)13-17(7-2)22(16)23-24(30)27(4)21-14-19(26(34-21)28(27,5)25(23)31)18-10-8-9-11-20(18)29(32)33/h8-13,19,21,26,31H,6-7,14H2,1-5H3/t19?,21-,26?,27+,28+/m0/s1 |
| InChIKey | YNXPXAHFBPMHPO-FVLSEADESA-N |
| XLogP | 5.85 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|