C28H32F2O2 — CID 71032839
(3aR,7aS)-2-(2,6-diethyl-4-methylphenyl)-5-(3,5-difluorophenyl)-3-hydroxy-4,7-dimethyl-3a,4,5,6,7,7a-hexahydroinden-1-one (PubChem CID 71032839) has the molecular formula C28H32F2O2 and a molecular weight of 438.56 g/mol. Its IUPAC name is (3aR,7aS)-2-(2,6-diethyl-4-methylphenyl)-5-(3,5-difluorophenyl)-3-hydroxy-4,7-dimethyl-3a,4,5,6,7,7a-hexahydroinden-1-one.
| Compound Name | (3aR,7aS)-2-(2,6-diethyl-4-methylphenyl)-5-(3,5-difluorophenyl)-3-hydroxy-4,7-dimethyl-3a,4,5,6,7,7a-hexahydroinden-1-one |
|---|---|
| PubChem CID | 71032839 |
| Molecular Formula | C28H32F2O2 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (3aR,7aS)-2-(2,6-diethyl-4-methylphenyl)-5-(3,5-difluorophenyl)-3-hydroxy-4,7-dimethyl-3a,4,5,6,7,7a-hexahydroinden-1-one |
| SMILES | CCc1cc(C)cc(CC)c1C1=C(O)[C@@H]2C(C)C(c3cc(F)cc(F)c3)CC(C)[C@@H]2C1=O |
| InChI | InChI=1S/C28H32F2O2/c1-6-17-8-14(3)9-18(7-2)25(17)26-27(31)23-15(4)10-22(16(5)24(23)28(26)32)19-11-20(29)13-21(30)12-19/h8-9,11-13,15-16,22-24,32H,6-7,10H2,1-5H3/t15?,16?,22?,23-,24+/m0/s1 |
| InChIKey | ANJBUUAHNAIJLW-UGOURPNPSA-N |
| XLogP | 6.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |