C22H26O5 — CID 7103304
(2S,4R)-4-[(1R,2R)-2-hydroxy-6-oxocyclohexyl]-2-(4-methoxyphenyl)-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 7103304) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is (2S,4R)-4-[(1R,2R)-2-hydroxy-6-oxocyclohexyl]-2-(4-methoxyphenyl)-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | (2S,4R)-4-[(1R,2R)-2-hydroxy-6-oxocyclohexyl]-2-(4-methoxyphenyl)-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 7103304 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (2S,4R)-4-[(1R,2R)-2-hydroxy-6-oxocyclohexyl]-2-(4-methoxyphenyl)-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | COc1ccc([C@@H]2C[C@H]([C@H]3C(=O)CCC[C@H]3O)C3=C(CCCC3=O)O2)cc1 |
| InChI | InChI=1S/C22H26O5/c1-26-14-10-8-13(9-11-14)20-12-15(21-16(23)4-2-5-17(21)24)22-18(25)6-3-7-19(22)27-20/h8-11,15-16,20-21,23H,2-7,12H2,1H3/t15-,16-,20+,21-/m1/s1 |
| InChIKey | QRSLYQPONMQITO-WWEWDKITSA-N |
| XLogP | 3.51 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |