C28H31F2N9OS — CID 71033482
N-(2,6-difluorophenyl)-2-[4-[6-methyl-8-[[3-[(3-methylpiperidin-1-yl)methyl]-4,5-dihydro-1,2-thiazol-5-yl]amino]imidazo[1,2-a]pyrazin-3-yl]pyrazol-1-yl]acetamide (PubChem CID 71033482) has the molecular formula C28H31F2N9OS and a molecular weight of 579.68 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-[4-[6-methyl-8-[[3-[(3-methylpiperidin-1-yl)methyl]-4,5-dihydro-1,2-thiazol-5-yl]amino]imidazo[1,2-a]pyrazin-3-yl]pyrazol-1-yl]acetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-[4-[6-methyl-8-[[3-[(3-methylpiperidin-1-yl)methyl]-4,5-dihydro-1,2-thiazol-5-yl]amino]imidazo[1,2-a]pyrazin-3-yl]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 71033482 |
| Molecular Formula | C28H31F2N9OS |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-[4-[6-methyl-8-[[3-[(3-methylpiperidin-1-yl)methyl]-4,5-dihydro-1,2-thiazol-5-yl]amino]imidazo[1,2-a]pyrazin-3-yl]pyrazol-1-yl]acetamide |
| SMILES | Cc1cn2c(-c3cnn(CC(=O)Nc4c(F)cccc4F)c3)cnc2c(NC2CC(CN3CCCC(C)C3)=NS2)n1 |
| InChI | InChI=1S/C28H31F2N9OS/c1-17-5-4-8-37(12-17)15-20-9-25(41-36-20)35-27-28-31-11-23(39(28)13-18(2)33-27)19-10-32-38(14-19)16-24(40)34-26-21(29)6-3-7-22(26)30/h3,6-7,10-11,13-14,17,25H,4-5,8-9,12,15-16H2,1-2H3,(H,33,35)(H,34,40) |
| InChIKey | ZEMFDBRMCCKHAF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|