C14H20N4S — CID 71033882
N,5-diethyl-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 71033882) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is N,5-diethyl-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | N,5-diethyl-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 71033882 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N,5-diethyl-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | CCNc1nc(CC)nc2sc3c(c12)CCN(C)C3 |
| InChI | InChI=1S/C14H20N4S/c1-4-11-16-13(15-5-2)12-9-6-7-18(3)8-10(9)19-14(12)17-11/h4-8H2,1-3H3,(H,15,16,17) |
| InChIKey | VLCKOZSOCHJKPH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |