C41H47BO10S — CID 71034078
methyl (3S,4R,5S)-3,4,5-tris(phenylmethoxy)-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylmethyl]oxane-2-carboxylate (PubChem CID 71034078) has the molecular formula C41H47BO10S and a molecular weight of 742.70 g/mol. Its IUPAC name is methyl (3S,4R,5S)-3,4,5-tris(phenylmethoxy)-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylmethyl]oxane-2-carboxylate.
| Compound Name | methyl (3S,4R,5S)-3,4,5-tris(phenylmethoxy)-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylmethyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 71034078 |
| Molecular Formula | C41H47BO10S |
| Molecular Weight | 742.70 g/mol |
| Exact Mass | 742.30 |
| IUPAC Name | methyl (3S,4R,5S)-3,4,5-tris(phenylmethoxy)-6-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylmethyl]oxane-2-carboxylate |
| SMILES | COC(=O)C1OC(CS(=O)(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H47BO10S/c1-40(2)41(3,4)52-42(51-40)32-21-23-33(24-22-32)53(44,45)28-34-35(47-25-29-15-9-6-10-16-29)36(48-26-30-17-11-7-12-18-30)37(38(50-34)39(43)46-5)49-27-31-19-13-8-14-20-31/h6-24,34-38H,25-28H2,1-5H3/t34?,35-,36+,37+,38?/m1/s1 |
| InChIKey | BPKRFOGLAKXOLB-CLRVRLMYSA-N |
| XLogP | 5.46 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|