About N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine
N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine (PubChem CID 71034599) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine.
Molecular Properties
| Compound Name | N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine |
| PubChem CID | 71034599 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine |
| SMILES | COCC[C@H](NC1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C14H29NO/c1-14(2,3)13(10-11-16-4)15-12-8-6-5-7-9-12/h12-13,15H,5-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | OVMGSJLEBXGCMG-ZDUSSCGKSA-N |
| XLogP | 3.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine?
The IUPAC name of N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine (CID 71034599) is N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine.
What is the SMILES notation for N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine?
The canonical SMILES for N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine is COCC[C@H](NC1CCCCC1)C(C)(C)C.
What is the InChIKey of N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine?
The InChIKey is OVMGSJLEBXGCMG-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H29NO/c1-14(2,3)13(10-11-16-4)15-12-8-6-5-7-9-12/h12-13,15H,5-11H2,1-4H3/t13-/m0/s1.
What are the key properties of N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine?
N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine has a molecular weight of 227.39 g/mol, XLogP of 3.36, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclohexanamine is sourced from PubChem (CID 71034599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).