About 2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide
2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide (PubChem CID 71035225) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide |
| PubChem CID | 71035225 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide |
| SMILES | NC(=O)C[C@H]1CC(=O)c2ccccc2N1 |
| InChI | InChI=1S/C11H12N2O2/c12-11(15)6-7-5-10(14)8-3-1-2-4-9(8)13-7/h1-4,7,13H,5-6H2,(H2,12,15)/t7-/m1/s1 |
| InChIKey | VEVMRAFRJBYYHW-SSDOTTSWSA-N |
| XLogP | 0.93 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide?
The IUPAC name of 2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide (CID 71035225) is 2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide.
What is the SMILES notation for 2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide?
The canonical SMILES for 2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide is NC(=O)C[C@H]1CC(=O)c2ccccc2N1.
What is the InChIKey of 2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide?
The InChIKey is VEVMRAFRJBYYHW-SSDOTTSWSA-N. The full InChI is InChI=1S/C11H12N2O2/c12-11(15)6-7-5-10(14)8-3-1-2-4-9(8)13-7/h1-4,7,13H,5-6H2,(H2,12,15)/t7-/m1/s1.
What are the key properties of 2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide?
2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide has a molecular weight of 204.23 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-4-oxo-2,3-dihydro-1H-quinolin-2-yl]acetamide is sourced from PubChem (CID 71035225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).