About CID 71036114
CID 71036114 (PubChem CID 71036114) has the molecular formula C23H22BN2O4
and a molecular weight of 401.25 g/mol.
Molecular Properties
| Compound Name | CID 71036114 |
| PubChem CID | 71036114 |
| Molecular Formula | C23H22BN2O4 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | — |
| SMILES | O=C[B]N1CCC[C@H]1CN1C(=O)C2(COc3cc4c(cc32)CCO4)c2ccccc21 |
| InChI | InChI=1S/C23H22BN2O4/c27-14-24-26-8-3-4-16(26)12-25-19-6-2-1-5-17(19)23(22(25)28)13-30-21-11-20-15(7-9-29-20)10-18(21)23/h1-2,5-6,10-11,14,16H,3-4,7-9,12-13H2/t16-,23?/m0/s1 |
| InChIKey | NYLMWYDGHWJQDL-GZWBLTSWSA-N |
| XLogP | 1.92 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 71036114 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71036114?
The IUPAC name of CID 71036114 (CID 71036114) is not available.
What is the SMILES notation for CID 71036114?
The canonical SMILES for CID 71036114 is O=C[B]N1CCC[C@H]1CN1C(=O)C2(COc3cc4c(cc32)CCO4)c2ccccc21.
What is the InChIKey of CID 71036114?
The InChIKey is NYLMWYDGHWJQDL-GZWBLTSWSA-N. The full InChI is InChI=1S/C23H22BN2O4/c27-14-24-26-8-3-4-16(26)12-25-19-6-2-1-5-17(19)23(22(25)28)13-30-21-11-20-15(7-9-29-20)10-18(21)23/h1-2,5-6,10-11,14,16H,3-4,7-9,12-13H2/t16-,23?/m0/s1.
What are the key properties of CID 71036114?
CID 71036114 has a molecular weight of 401.25 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71036114 is sourced from PubChem (CID 71036114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).