C18H19Cl2N3O3 — CID 71036178
4-(5-amino-2-pyridinyl)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one (PubChem CID 71036178) has the molecular formula C18H19Cl2N3O3 and a molecular weight of 396.27 g/mol. Its IUPAC name is 4-(5-amino-2-pyridinyl)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one.
| Compound Name | 4-(5-amino-2-pyridinyl)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one |
|---|---|
| PubChem CID | 71036178 |
| Molecular Formula | C18H19Cl2N3O3 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 4-(5-amino-2-pyridinyl)-1-(5,8-dichloro-6,7-dihydroxy-3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one |
| SMILES | Nc1ccc(CCCC(=O)N2CCc3c(Cl)c(O)c(O)c(Cl)c3C2)nc1 |
| InChI | InChI=1S/C18H19Cl2N3O3/c19-15-12-6-7-23(9-13(12)16(20)18(26)17(15)25)14(24)3-1-2-11-5-4-10(21)8-22-11/h4-5,8,25-26H,1-3,6-7,9,21H2 |
| InChIKey | TZBPELXKBICSPW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|