C14H13FN4O2 — CID 71036299
5-fluoro-13-(2-hydroxyethyl)-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one (PubChem CID 71036299) has the molecular formula C14H13FN4O2 and a molecular weight of 288.28 g/mol. Its IUPAC name is 5-fluoro-13-(2-hydroxyethyl)-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one.
| Compound Name | 5-fluoro-13-(2-hydroxyethyl)-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
|---|---|
| PubChem CID | 71036299 |
| Molecular Formula | C14H13FN4O2 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 5-fluoro-13-(2-hydroxyethyl)-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
| SMILES | CN1C(=O)c2cc(CCO)cnc2Nc2nc(F)ccc21 |
| InChI | InChI=1S/C14H13FN4O2/c1-19-10-2-3-11(15)17-13(10)18-12-9(14(19)21)6-8(4-5-20)7-16-12/h2-3,6-7,20H,4-5H2,1H3,(H,16,17,18) |
| InChIKey | HPQHYRZXBZPVJD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|