C33H29NO4 — CID 71036502
tert-butyl 4-[4-(8,14-dioxa-22-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaen-22-yl)phenyl]butanoate (PubChem CID 71036502) has the molecular formula C33H29NO4 and a molecular weight of 503.60 g/mol. Its IUPAC name is tert-butyl 4-[4-(8,14-dioxa-22-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaen-22-yl)phenyl]butanoate.
| Compound Name | tert-butyl 4-[4-(8,14-dioxa-22-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaen-22-yl)phenyl]butanoate |
|---|---|
| PubChem CID | 71036502 |
| Molecular Formula | C33H29NO4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | tert-butyl 4-[4-(8,14-dioxa-22-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaen-22-yl)phenyl]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCc1ccc(N2c3cccc4c3C3c5c(cccc5Oc5cccc2c53)O4)cc1 |
| InChI | InChI=1S/C33H29NO4/c1-33(2,3)38-28(35)15-4-8-20-16-18-21(19-17-20)34-22-9-5-11-24-29(22)32-30-23(34)10-6-12-25(30)37-27-14-7-13-26(36-24)31(27)32/h5-7,9-14,16-19,32H,4,8,15H2,1-3H3 |
| InChIKey | WQLAJUAALJZLOP-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |