C16H24N2O2 — CID 71036532
N-(1-amino-1-oxo-3-phenylpropan-2-yl)-2,3-dimethylpentanamide (PubChem CID 71036532) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-(1-amino-1-oxo-3-phenylpropan-2-yl)-2,3-dimethylpentanamide.
| Compound Name | N-(1-amino-1-oxo-3-phenylpropan-2-yl)-2,3-dimethylpentanamide |
|---|---|
| PubChem CID | 71036532 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N-(1-amino-1-oxo-3-phenylpropan-2-yl)-2,3-dimethylpentanamide |
| SMILES | CCC(C)C(C)C(=O)NC(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C16H24N2O2/c1-4-11(2)12(3)16(20)18-14(15(17)19)10-13-8-6-5-7-9-13/h5-9,11-12,14H,4,10H2,1-3H3,(H2,17,19)(H,18,20) |
| InChIKey | WWWIRFNCYSISDB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |