C12H15N3O — CID 71036827
(4aS)-7-methyl-1,2,3,4,4a,5-hexahydropyrazino[1,2-a]quinazolin-6-one (PubChem CID 71036827) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is (4aS)-7-methyl-1,2,3,4,4a,5-hexahydropyrazino[1,2-a]quinazolin-6-one.
| Compound Name | (4aS)-7-methyl-1,2,3,4,4a,5-hexahydropyrazino[1,2-a]quinazolin-6-one |
|---|---|
| PubChem CID | 71036827 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (4aS)-7-methyl-1,2,3,4,4a,5-hexahydropyrazino[1,2-a]quinazolin-6-one |
| SMILES | Cc1cccc2c1C(=O)N[C@@H]1CNCCN21 |
| InChI | InChI=1S/C12H15N3O/c1-8-3-2-4-9-11(8)12(16)14-10-7-13-5-6-15(9)10/h2-4,10,13H,5-7H2,1H3,(H,14,16)/t10-/m0/s1 |
| InChIKey | RGCZEETYNQZRTH-JTQLQIEISA-N |
| XLogP | 0.47 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |