C20H40O4 — CID 71037459
2,3,5,6-tetratert-butyl-1,4-dioxane-2,5-diol (PubChem CID 71037459) has the molecular formula C20H40O4 and a molecular weight of 344.54 g/mol. Its IUPAC name is 2,3,5,6-tetratert-butyl-1,4-dioxane-2,5-diol.
| Compound Name | 2,3,5,6-tetratert-butyl-1,4-dioxane-2,5-diol |
|---|---|
| PubChem CID | 71037459 |
| Molecular Formula | C20H40O4 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | 2,3,5,6-tetratert-butyl-1,4-dioxane-2,5-diol |
| SMILES | CC(C)(C)C1OC(O)(C(C)(C)C)C(C(C)(C)C)OC1(O)C(C)(C)C |
| InChI | InChI=1S/C20H40O4/c1-15(2,3)13-19(21,17(7,8)9)24-14(16(4,5)6)20(22,23-13)18(10,11)12/h13-14,21-22H,1-12H3 |
| InChIKey | NCRPSYBXSHZZLV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |