C14H25F3O4 — CID 71037474
(2R,3S,5R,6S)-3,6-ditert-butyl-2-methyl-5-(trifluoromethyl)-1,4-dioxane-2,5-diol (PubChem CID 71037474) has the molecular formula C14H25F3O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is (2R,3S,5R,6S)-3,6-ditert-butyl-2-methyl-5-(trifluoromethyl)-1,4-dioxane-2,5-diol.
| Compound Name | (2R,3S,5R,6S)-3,6-ditert-butyl-2-methyl-5-(trifluoromethyl)-1,4-dioxane-2,5-diol |
|---|---|
| PubChem CID | 71037474 |
| Molecular Formula | C14H25F3O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2R,3S,5R,6S)-3,6-ditert-butyl-2-methyl-5-(trifluoromethyl)-1,4-dioxane-2,5-diol |
| SMILES | CC(C)(C)[C@@H]1O[C@@](O)(C(F)(F)F)[C@H](C(C)(C)C)O[C@@]1(C)O |
| InChI | InChI=1S/C14H25F3O4/c1-10(2,3)8-12(7,18)20-9(11(4,5)6)13(19,21-8)14(15,16)17/h8-9,18-19H,1-7H3/t8-,9-,12+,13+/m0/s1 |
| InChIKey | WUJAAJNWDKGMCH-RBJBARPLSA-N |
| XLogP | 2.82 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |