C14H25F3O6 — CID 71037501
(2S,3R,5S,6R)-2,5-ditert-butyl-3-methyl-6-(trifluoromethyl)-1,4-dioxane-2,3,5,6-tetrol (PubChem CID 71037501) has the molecular formula C14H25F3O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is (2S,3R,5S,6R)-2,5-ditert-butyl-3-methyl-6-(trifluoromethyl)-1,4-dioxane-2,3,5,6-tetrol.
| Compound Name | (2S,3R,5S,6R)-2,5-ditert-butyl-3-methyl-6-(trifluoromethyl)-1,4-dioxane-2,3,5,6-tetrol |
|---|---|
| PubChem CID | 71037501 |
| Molecular Formula | C14H25F3O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (2S,3R,5S,6R)-2,5-ditert-butyl-3-methyl-6-(trifluoromethyl)-1,4-dioxane-2,3,5,6-tetrol |
| SMILES | CC(C)(C)[C@]1(O)O[C@@](C)(O)[C@](O)(C(C)(C)C)O[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C14H25F3O6/c1-8(2,3)11(19)10(7,18)22-12(20,9(4,5)6)13(21,23-11)14(15,16)17/h18-21H,1-7H3/t10-,11+,12+,13-/m1/s1 |
| InChIKey | MMXWVHIOBGGAJF-MROQNXINSA-N |
| XLogP | 1.46 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |