C14H30N2O4 — CID 71037558
3,6-bis(diethylaminomethyl)-1,4-dioxane-2,5-diol (PubChem CID 71037558) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is 3,6-bis(diethylaminomethyl)-1,4-dioxane-2,5-diol.
| Compound Name | 3,6-bis(diethylaminomethyl)-1,4-dioxane-2,5-diol |
|---|---|
| PubChem CID | 71037558 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 3,6-bis(diethylaminomethyl)-1,4-dioxane-2,5-diol |
| SMILES | CCN(CC)CC1OC(O)C(CN(CC)CC)OC1O |
| InChI | InChI=1S/C14H30N2O4/c1-5-15(6-2)9-11-13(17)20-12(14(18)19-11)10-16(7-3)8-4/h11-14,17-18H,5-10H2,1-4H3 |
| InChIKey | QOUZPTUBOXTDNZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |