C15H28N6 — CID 71037905
2-[3-[bis(dimethylamino)methylideneamino]cyclopenta-1,3-dien-1-yl]-1,1,3,3-tetramethylguanidine (PubChem CID 71037905) has the molecular formula C15H28N6 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-[3-[bis(dimethylamino)methylideneamino]cyclopenta-1,3-dien-1-yl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[3-[bis(dimethylamino)methylideneamino]cyclopenta-1,3-dien-1-yl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 71037905 |
| Molecular Formula | C15H28N6 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2-[3-[bis(dimethylamino)methylideneamino]cyclopenta-1,3-dien-1-yl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NC1=CCC(N=C(N(C)C)N(C)C)=C1)N(C)C |
| InChI | InChI=1S/C15H28N6/c1-18(2)14(19(3)4)16-12-9-10-13(11-12)17-15(20(5)6)21(7)8/h9,11H,10H2,1-8H3 |
| InChIKey | DMAKREYCOJOLRW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|