C20H39N9 — CID 71037908
2-[2,3-bis[bis(dimethylamino)methylideneamino]cyclopenta-1,3-dien-1-yl]-1,1,3,3-tetramethylguanidine (PubChem CID 71037908) has the molecular formula C20H39N9 and a molecular weight of 405.60 g/mol. Its IUPAC name is 2-[2,3-bis[bis(dimethylamino)methylideneamino]cyclopenta-1,3-dien-1-yl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[2,3-bis[bis(dimethylamino)methylideneamino]cyclopenta-1,3-dien-1-yl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 71037908 |
| Molecular Formula | C20H39N9 |
| Molecular Weight | 405.60 g/mol |
| Exact Mass | 405.33 |
| IUPAC Name | 2-[2,3-bis[bis(dimethylamino)methylideneamino]cyclopenta-1,3-dien-1-yl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NC1=CCC(N=C(N(C)C)N(C)C)=C1N=C(N(C)C)N(C)C)N(C)C |
| InChI | InChI=1S/C20H39N9/c1-24(2)18(25(3)4)21-15-13-14-16(22-19(26(5)6)27(7)8)17(15)23-20(28(9)10)29(11)12/h13H,14H2,1-12H3 |
| InChIKey | MHOVADVHSJKWJU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 56.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.60 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|