C22H30N6S — CID 71037975
2-[9-[bis(dimethylamino)methylideneamino]dibenzothiophen-1-yl]-1,1,3,3-tetramethylguanidine (PubChem CID 71037975) has the molecular formula C22H30N6S and a molecular weight of 410.59 g/mol. Its IUPAC name is 2-[9-[bis(dimethylamino)methylideneamino]dibenzothiophen-1-yl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[9-[bis(dimethylamino)methylideneamino]dibenzothiophen-1-yl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 71037975 |
| Molecular Formula | C22H30N6S |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-[9-[bis(dimethylamino)methylideneamino]dibenzothiophen-1-yl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=Nc1cccc2sc3cccc(N=C(N(C)C)N(C)C)c3c12)N(C)C |
| InChI | InChI=1S/C22H30N6S/c1-25(2)21(26(3)4)23-15-11-9-13-17-19(15)20-16(12-10-14-18(20)29-17)24-22(27(5)6)28(7)8/h9-14H,1-8H3 |
| InChIKey | IWDUNBODYDMHKY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|