C19H18ClF2N3O — CID 71038091
N-[(1S,8R,11E)-11-(1-chloroethylidene)-3-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide (PubChem CID 71038091) has the molecular formula C19H18ClF2N3O and a molecular weight of 377.82 g/mol. Its IUPAC name is N-[(1S,8R,11E)-11-(1-chloroethylidene)-3-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[(1S,8R,11E)-11-(1-chloroethylidene)-3-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71038091 |
| Molecular Formula | C19H18ClF2N3O |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[(1S,8R,11E)-11-(1-chloroethylidene)-3-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
| SMILES | C/C(Cl)=C1\[C@H]2CC[C@@H]1c1cccc(NC(=O)c3cn(C)nc3C(F)F)c12 |
| InChI | InChI=1S/C19H18ClF2N3O/c1-9(20)15-11-6-7-12(15)16-10(11)4-3-5-14(16)23-19(26)13-8-25(2)24-17(13)18(21)22/h3-5,8,11-12,18H,6-7H2,1-2H3,(H,23,26)/b15-9+/t11-,12-/m1/s1 |
| InChIKey | RJEMCGQRZLIINN-ZOPJJOQRSA-N |
| XLogP | 5.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |