About (3S)-3-iodo-3,7-dimethyl-2H-thianthrene
(3S)-3-iodo-3,7-dimethyl-2H-thianthrene (PubChem CID 71039151) has the molecular formula C14H13IS2
and a molecular weight of 372.30 g/mol. Its IUPAC name is (3S)-3-iodo-3,7-dimethyl-2H-thianthrene.
Molecular Properties
| Compound Name | (3S)-3-iodo-3,7-dimethyl-2H-thianthrene |
| PubChem CID | 71039151 |
| Molecular Formula | C14H13IS2 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | (3S)-3-iodo-3,7-dimethyl-2H-thianthrene |
| SMILES | Cc1ccc2c(c1)SC1=C[C@@](C)(I)CC=C1S2 |
| InChI | InChI=1S/C14H13IS2/c1-9-3-4-10-12(7-9)17-13-8-14(2,15)6-5-11(13)16-10/h3-5,7-8H,6H2,1-2H3/t14-/m0/s1 |
| InChIKey | LWKOGUHBHFTBHQ-AWEZNQCLSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-iodo-3,7-dimethyl-2H-thianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-iodo-3,7-dimethyl-2H-thianthrene?
The IUPAC name of (3S)-3-iodo-3,7-dimethyl-2H-thianthrene (CID 71039151) is (3S)-3-iodo-3,7-dimethyl-2H-thianthrene.
What is the SMILES notation for (3S)-3-iodo-3,7-dimethyl-2H-thianthrene?
The canonical SMILES for (3S)-3-iodo-3,7-dimethyl-2H-thianthrene is Cc1ccc2c(c1)SC1=C[C@@](C)(I)CC=C1S2.
What is the InChIKey of (3S)-3-iodo-3,7-dimethyl-2H-thianthrene?
The InChIKey is LWKOGUHBHFTBHQ-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H13IS2/c1-9-3-4-10-12(7-9)17-13-8-14(2,15)6-5-11(13)16-10/h3-5,7-8H,6H2,1-2H3/t14-/m0/s1.
What are the key properties of (3S)-3-iodo-3,7-dimethyl-2H-thianthrene?
(3S)-3-iodo-3,7-dimethyl-2H-thianthrene has a molecular weight of 372.30 g/mol, XLogP of 5.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-iodo-3,7-dimethyl-2H-thianthrene is sourced from PubChem (CID 71039151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).