About 2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid
2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid (PubChem CID 71039217) has the molecular formula C22H28N2O6
and a molecular weight of 416.47 g/mol. Its IUPAC name is 2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid.
Molecular Properties
| Compound Name | 2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid |
| PubChem CID | 71039217 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid |
| SMILES | CC(C)CCOCc1ccc(C(=O)O)c(NC(=O)CCCCN2C(=O)C=CC2=O)c1 |
| InChI | InChI=1S/C22H28N2O6/c1-15(2)10-12-30-14-16-6-7-17(22(28)29)18(13-16)23-19(25)5-3-4-11-24-20(26)8-9-21(24)27/h6-9,13,15H,3-5,10-12,14H2,1-2H3,(H,23,25)(H,28,29) |
| InChIKey | OIBCXNWHDJRVEH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid?
The IUPAC name of 2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid (CID 71039217) is 2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid.
What is the SMILES notation for 2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid?
The canonical SMILES for 2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid is CC(C)CCOCc1ccc(C(=O)O)c(NC(=O)CCCCN2C(=O)C=CC2=O)c1.
What is the InChIKey of 2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid?
The InChIKey is OIBCXNWHDJRVEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O6/c1-15(2)10-12-30-14-16-6-7-17(22(28)29)18(13-16)23-19(25)5-3-4-11-24-20(26)8-9-21(24)27/h6-9,13,15H,3-5,10-12,14H2,1-2H3,(H,23,25)(H,28,29).
What are the key properties of 2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid?
2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid has a molecular weight of 416.47 g/mol, XLogP of 2.98, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,5-dioxopyrrol-1-yl)pentanoylamino]-4-(3-methylbutoxymethyl)benzoic acid is sourced from PubChem (CID 71039217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).