C21H24F2N2S — CID 71039263
(4aS,9bR)-8-(2,6-difluorophenyl)-6-methylsulfanyl-5-propyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole (PubChem CID 71039263) has the molecular formula C21H24F2N2S and a molecular weight of 374.50 g/mol. Its IUPAC name is (4aS,9bR)-8-(2,6-difluorophenyl)-6-methylsulfanyl-5-propyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | (4aS,9bR)-8-(2,6-difluorophenyl)-6-methylsulfanyl-5-propyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 71039263 |
| Molecular Formula | C21H24F2N2S |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (4aS,9bR)-8-(2,6-difluorophenyl)-6-methylsulfanyl-5-propyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
| SMILES | CCCN1c2c(SC)cc(-c3c(F)cccc3F)cc2[C@@H]2CNCC[C@@H]21 |
| InChI | InChI=1S/C21H24F2N2S/c1-3-9-25-18-7-8-24-12-15(18)14-10-13(11-19(26-2)21(14)25)20-16(22)5-4-6-17(20)23/h4-6,10-11,15,18,24H,3,7-9,12H2,1-2H3/t15-,18-/m0/s1 |
| InChIKey | AWGLXWOFJAIJSD-YJBOKZPZSA-N |
| XLogP | 5.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |