C18H23O3P — CID 71039887
2-[2-[2-(hydroxymethyl)phenyl]phosphanylbutan-2-yl]-4-methoxyphenol (PubChem CID 71039887) has the molecular formula C18H23O3P and a molecular weight of 318.35 g/mol. Its IUPAC name is 2-[2-[2-(hydroxymethyl)phenyl]phosphanylbutan-2-yl]-4-methoxyphenol.
| Compound Name | 2-[2-[2-(hydroxymethyl)phenyl]phosphanylbutan-2-yl]-4-methoxyphenol |
|---|---|
| PubChem CID | 71039887 |
| Molecular Formula | C18H23O3P |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-[2-[2-(hydroxymethyl)phenyl]phosphanylbutan-2-yl]-4-methoxyphenol |
| SMILES | CCC(C)(Pc1ccccc1CO)c1cc(OC)ccc1O |
| InChI | InChI=1S/C18H23O3P/c1-4-18(2,15-11-14(21-3)9-10-16(15)20)22-17-8-6-5-7-13(17)12-19/h5-11,19-20,22H,4,12H2,1-3H3 |
| InChIKey | KNCILHNUQBYKPD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|