About 2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol
2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol (PubChem CID 71040213) has the molecular formula C19H24FOP
and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol.
Molecular Properties
| Compound Name | 2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol |
| PubChem CID | 71040213 |
| Molecular Formula | C19H24FOP |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol |
| SMILES | CCC(C)(Pc1c(C)cccc1F)c1cc(C)cc(C)c1O |
| InChI | InChI=1S/C19H24FOP/c1-6-19(5,15-11-12(2)10-14(4)17(15)21)22-18-13(3)8-7-9-16(18)20/h7-11,21-22H,6H2,1-5H3 |
| InChIKey | LQZPDYWJWMKCEP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol?
The IUPAC name of 2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol (CID 71040213) is 2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol.
What is the SMILES notation for 2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol?
The canonical SMILES for 2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol is CCC(C)(Pc1c(C)cccc1F)c1cc(C)cc(C)c1O.
What is the InChIKey of 2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol?
The InChIKey is LQZPDYWJWMKCEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24FOP/c1-6-19(5,15-11-12(2)10-14(4)17(15)21)22-18-13(3)8-7-9-16(18)20/h7-11,21-22H,6H2,1-5H3.
What are the key properties of 2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol?
2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol has a molecular weight of 318.37 g/mol, XLogP of 5.09, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-fluoro-6-methylphenyl)phosphanylbutan-2-yl]-4,6-dimethylphenol is sourced from PubChem (CID 71040213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).