About 5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide
5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide (PubChem CID 71040291) has the molecular formula C11H16F2N2O
and a molecular weight of 230.26 g/mol. Its IUPAC name is 5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide.
Molecular Properties
| Compound Name | 5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide |
| PubChem CID | 71040291 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide |
| SMILES | NCCCCC(=O)NC1C=C(F)C(F)=CC1 |
| InChI | InChI=1S/C11H16F2N2O/c12-9-5-4-8(7-10(9)13)15-11(16)3-1-2-6-14/h5,7-8H,1-4,6,14H2,(H,15,16) |
| InChIKey | VKUSZNJQMZMBGS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide?
The IUPAC name of 5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide (CID 71040291) is 5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide.
What is the SMILES notation for 5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide?
The canonical SMILES for 5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide is NCCCCC(=O)NC1C=C(F)C(F)=CC1.
What is the InChIKey of 5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide?
The InChIKey is VKUSZNJQMZMBGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2N2O/c12-9-5-4-8(7-10(9)13)15-11(16)3-1-2-6-14/h5,7-8H,1-4,6,14H2,(H,15,16).
What are the key properties of 5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide?
5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide has a molecular weight of 230.26 g/mol, XLogP of 1.71, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-(3,4-difluorocyclohexa-2,4-dien-1-yl)pentanamide is sourced from PubChem (CID 71040291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).