C18H30N2O5S — CID 71040477
N-[(4aR)-3-methyl-2,3,4a,5-tetrahydro-1,4-benzodioxin-6-yl]-5-(tert-butylsulfonylamino)pentanamide (PubChem CID 71040477) has the molecular formula C18H30N2O5S and a molecular weight of 386.51 g/mol. Its IUPAC name is N-[(4aR)-3-methyl-2,3,4a,5-tetrahydro-1,4-benzodioxin-6-yl]-5-(tert-butylsulfonylamino)pentanamide.
| Compound Name | N-[(4aR)-3-methyl-2,3,4a,5-tetrahydro-1,4-benzodioxin-6-yl]-5-(tert-butylsulfonylamino)pentanamide |
|---|---|
| PubChem CID | 71040477 |
| Molecular Formula | C18H30N2O5S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N-[(4aR)-3-methyl-2,3,4a,5-tetrahydro-1,4-benzodioxin-6-yl]-5-(tert-butylsulfonylamino)pentanamide |
| SMILES | CC1COC2=CC=C(NC(=O)CCCCNS(=O)(=O)C(C)(C)C)C[C@H]2O1 |
| InChI | InChI=1S/C18H30N2O5S/c1-13-12-24-15-9-8-14(11-16(15)25-13)20-17(21)7-5-6-10-19-26(22,23)18(2,3)4/h8-9,13,16,19H,5-7,10-12H2,1-4H3,(H,20,21)/t13?,16-/m1/s1 |
| InChIKey | WVOVFGCKGVGAMZ-FQNRMIAFSA-N |
| XLogP | 1.97 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|