About 5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide
5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide (PubChem CID 71040546) has the molecular formula C16H29N3O2
and a molecular weight of 295.43 g/mol. Its IUPAC name is 5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide.
Molecular Properties
| Compound Name | 5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide |
| PubChem CID | 71040546 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide |
| SMILES | CNCCOCC1=CCC(NC(=O)CCCCN)C(C)=C1 |
| InChI | InChI=1S/C16H29N3O2/c1-13-11-14(12-21-10-9-18-2)6-7-15(13)19-16(20)5-3-4-8-17/h6,11,15,18H,3-5,7-10,12,17H2,1-2H3,(H,19,20) |
| InChIKey | NRIGQNZSDAXTEV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide?
The IUPAC name of 5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide (CID 71040546) is 5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide.
What is the SMILES notation for 5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide?
The canonical SMILES for 5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide is CNCCOCC1=CCC(NC(=O)CCCCN)C(C)=C1.
What is the InChIKey of 5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide?
The InChIKey is NRIGQNZSDAXTEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N3O2/c1-13-11-14(12-21-10-9-18-2)6-7-15(13)19-16(20)5-3-4-8-17/h6,11,15,18H,3-5,7-10,12,17H2,1-2H3,(H,19,20).
What are the key properties of 5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide?
5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide has a molecular weight of 295.43 g/mol, XLogP of 1.11, 10 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-[2-methyl-4-[2-(methylamino)ethoxymethyl]cyclohexa-2,4-dien-1-yl]pentanamide is sourced from PubChem (CID 71040546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).