C25H39N5O — CID 71040584
4-amino-N-[3-[3-[4-(1,4-dihydropyrimidin-2-yl)phenyl]propyl-ethylamino]propyl]cyclohexane-1-carboxamide (PubChem CID 71040584) has the molecular formula C25H39N5O and a molecular weight of 425.62 g/mol. Its IUPAC name is 4-amino-N-[3-[3-[4-(1,4-dihydropyrimidin-2-yl)phenyl]propyl-ethylamino]propyl]cyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-[3-[3-[4-(1,4-dihydropyrimidin-2-yl)phenyl]propyl-ethylamino]propyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 71040584 |
| Molecular Formula | C25H39N5O |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.32 |
| IUPAC Name | 4-amino-N-[3-[3-[4-(1,4-dihydropyrimidin-2-yl)phenyl]propyl-ethylamino]propyl]cyclohexane-1-carboxamide |
| SMILES | CCN(CCCNC(=O)C1CCC(N)CC1)CCCc1ccc(C2=NCC=CN2)cc1 |
| InChI | InChI=1S/C25H39N5O/c1-2-30(19-5-17-29-25(31)22-11-13-23(26)14-12-22)18-3-6-20-7-9-21(10-8-20)24-27-15-4-16-28-24/h4,7-10,15,22-23H,2-3,5-6,11-14,16-19,26H2,1H3,(H,27,28)(H,29,31) |
| InChIKey | MWDQFXDRSZAHMY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|