C28H38O6Si — CID 71040617
[1-[(3aS,4R,6R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-methylpropan-2-yl]-hydroxy-diphenylsilane (PubChem CID 71040617) has the molecular formula C28H38O6Si and a molecular weight of 498.69 g/mol. Its IUPAC name is [1-[(3aS,4R,6R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-methylpropan-2-yl]-hydroxy-diphenylsilane.
| Compound Name | [1-[(3aS,4R,6R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-methylpropan-2-yl]-hydroxy-diphenylsilane |
|---|---|
| PubChem CID | 71040617 |
| Molecular Formula | C28H38O6Si |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | [1-[(3aS,4R,6R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-methylpropan-2-yl]-hydroxy-diphenylsilane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CC(C)(C)[Si](O)(c1ccccc1)c1ccccc1)O[C@@H]2[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C28H38O6Si/c1-26(2,35(29,19-13-9-7-10-14-19)20-15-11-8-12-16-20)17-21-24-25(34-28(5,6)33-24)23(31-21)22-18-30-27(3,4)32-22/h7-16,21-25,29H,17-18H2,1-6H3/t21-,22-,23-,24-,25+/m1/s1 |
| InChIKey | QCIGPXQANGUPBW-JYSSUKAJSA-N |
| XLogP | 3.35 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|