C17H20O6S — CID 71040646
[(6R,8aR)-6-ethylsulfanyl-8-oxo-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl] acetate (PubChem CID 71040646) has the molecular formula C17H20O6S and a molecular weight of 352.41 g/mol. Its IUPAC name is [(6R,8aR)-6-ethylsulfanyl-8-oxo-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl] acetate.
| Compound Name | [(6R,8aR)-6-ethylsulfanyl-8-oxo-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl] acetate |
|---|---|
| PubChem CID | 71040646 |
| Molecular Formula | C17H20O6S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | [(6R,8aR)-6-ethylsulfanyl-8-oxo-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl] acetate |
| SMILES | CCS[C@H]1OC2COC(c3ccccc3)O[C@H]2C(=O)C1OC(C)=O |
| InChI | InChI=1S/C17H20O6S/c1-3-24-17-15(21-10(2)18)13(19)14-12(22-17)9-20-16(23-14)11-7-5-4-6-8-11/h4-8,12,14-17H,3,9H2,1-2H3/t12?,14-,15?,16?,17-/m1/s1 |
| InChIKey | PEDXVJRXFZPOFV-KOQIVIGESA-N |
| XLogP | 2.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |