C24H32Br2S2 — CID 71040736
2,6-dibromo-4,8-di(heptan-3-yl)thieno[2,3-f][1]benzothiole (PubChem CID 71040736) has the molecular formula C24H32Br2S2 and a molecular weight of 544.46 g/mol. Its IUPAC name is 2,6-dibromo-4,8-di(heptan-3-yl)thieno[2,3-f][1]benzothiole.
| Compound Name | 2,6-dibromo-4,8-di(heptan-3-yl)thieno[2,3-f][1]benzothiole |
|---|---|
| PubChem CID | 71040736 |
| Molecular Formula | C24H32Br2S2 |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | 2,6-dibromo-4,8-di(heptan-3-yl)thieno[2,3-f][1]benzothiole |
| SMILES | CCCCC(CC)c1c2cc(Br)sc2c(C(CC)CCCC)c2cc(Br)sc12 |
| InChI | InChI=1S/C24H32Br2S2/c1-5-9-11-15(7-3)21-17-13-19(25)28-24(17)22(16(8-4)12-10-6-2)18-14-20(26)27-23(18)21/h13-16H,5-12H2,1-4H3 |
| InChIKey | NKHKBRRVZQTSSO-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |