About (3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine
(3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine (PubChem CID 71040970) has the molecular formula C13H17F2NO
and a molecular weight of 241.28 g/mol. Its IUPAC name is (3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine.
Molecular Properties
| Compound Name | (3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine |
| PubChem CID | 71040970 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine |
| SMILES | COCCN1CC[C@H](c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C13H17F2NO/c1-17-7-6-16-5-4-11(9-16)10-2-3-12(14)13(15)8-10/h2-3,8,11H,4-7,9H2,1H3/t11-/m0/s1 |
| InChIKey | SKROAGLVTRGCMS-NSHDSACASA-N |
| XLogP | 2.40 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine?
The IUPAC name of (3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine (CID 71040970) is (3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine.
What is the SMILES notation for (3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine?
The canonical SMILES for (3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine is COCCN1CC[C@H](c2ccc(F)c(F)c2)C1.
What is the InChIKey of (3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine?
The InChIKey is SKROAGLVTRGCMS-NSHDSACASA-N. The full InChI is InChI=1S/C13H17F2NO/c1-17-7-6-16-5-4-11(9-16)10-2-3-12(14)13(15)8-10/h2-3,8,11H,4-7,9H2,1H3/t11-/m0/s1.
What are the key properties of (3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine?
(3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine has a molecular weight of 241.28 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidine is sourced from PubChem (CID 71040970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).