About 1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea
1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea (PubChem CID 71041152) has the molecular formula C21H25N5O2
and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea.
Molecular Properties
| Compound Name | 1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea |
| PubChem CID | 71041152 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea |
| SMILES | COCCN1CC(c2ccccc2)[C@H](NC(=O)Nc2cnn3ccccc23)C1 |
| InChI | InChI=1S/C21H25N5O2/c1-28-12-11-25-14-17(16-7-3-2-4-8-16)19(15-25)24-21(27)23-18-13-22-26-10-6-5-9-20(18)26/h2-10,13,17,19H,11-12,14-15H2,1H3,(H2,23,24,27)/t17?,19-/m1/s1 |
| InChIKey | JXXVKQOTWAPXMB-WHCXFUJUSA-N |
| XLogP | 2.57 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea?
The IUPAC name of 1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea (CID 71041152) is 1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea.
What is the SMILES notation for 1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea?
The canonical SMILES for 1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea is COCCN1CC(c2ccccc2)[C@H](NC(=O)Nc2cnn3ccccc23)C1.
What is the InChIKey of 1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea?
The InChIKey is JXXVKQOTWAPXMB-WHCXFUJUSA-N. The full InChI is InChI=1S/C21H25N5O2/c1-28-12-11-25-14-17(16-7-3-2-4-8-16)19(15-25)24-21(27)23-18-13-22-26-10-6-5-9-20(18)26/h2-10,13,17,19H,11-12,14-15H2,1H3,(H2,23,24,27)/t17?,19-/m1/s1.
What are the key properties of 1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea?
1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea has a molecular weight of 379.46 g/mol, XLogP of 2.57, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]-3-pyrazolo[1,5-a]pyridin-3-ylurea is sourced from PubChem (CID 71041152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).