C25H31N5O2 — CID 71041379
1-(1-ethyl-3-phenylpyrazol-5-yl)-3-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]urea (PubChem CID 71041379) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 1-(1-ethyl-3-phenylpyrazol-5-yl)-3-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]urea.
| Compound Name | 1-(1-ethyl-3-phenylpyrazol-5-yl)-3-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 71041379 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 1-(1-ethyl-3-phenylpyrazol-5-yl)-3-[(3S)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]urea |
| SMILES | CCn1nc(-c2ccccc2)cc1NC(=O)N[C@@H]1CN(CCOC)CC1c1ccccc1 |
| InChI | InChI=1S/C25H31N5O2/c1-3-30-24(16-22(28-30)20-12-8-5-9-13-20)27-25(31)26-23-18-29(14-15-32-2)17-21(23)19-10-6-4-7-11-19/h4-13,16,21,23H,3,14-15,17-18H2,1-2H3,(H2,26,27,31)/t21?,23-/m1/s1 |
| InChIKey | FEBWOYIPJAKVIF-JFGZAKSSSA-N |
| XLogP | 3.81 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |