About US10323022, Example 511
US10323022, Example 511 (PubChem CID 71041449) has the molecular formula C29H31F2N7O2
and a molecular weight of 547.60 g/mol. Its IUPAC name is 1-[(3S,4R)-4-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-yl]-3-[4-methyl-3-(2-methylpyrimidin-5-yl)-1-phenylpyrazol-5-yl]urea.
Molecular Properties
| Compound Name | US10323022, Example 511 |
| PubChem CID | 71041449 |
| Molecular Formula | C29H31F2N7O2 |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | 1-[(3S,4R)-4-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-yl]-3-[4-methyl-3-(2-methylpyrimidin-5-yl)-1-phenylpyrazol-5-yl]urea |
| SMILES | CC1=C(N(N=C1C2=CN=C(N=C2)C)C3=CC=CC=C3)NC(=O)N[C@@H]4CN(C[C@H]4C5=CC(=C(C=C5)F)F)CCOC |
| InChI | InChI=1S/C29H31F2N7O2/c1-18-27(21-14-32-19(2)33-15-21)36-38(22-7-5-4-6-8-22)28(18)35-29(39)34-26-17-37(11-12-40-3)16-23(26)20-9-10-24(30)25(31)13-20/h4-10,13-15,23,26H,11-12,16-17H2,1-3H3,(H2,34,35,39)/t23-,26+/m0/s1 |
| InChIKey | HMZMJVUIFWVPPL-JYFHCDHNSA-N |
| XLogP | 3.60 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | 813 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze US10323022, Example 511 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10323022, Example 511?
The IUPAC name of US10323022, Example 511 (CID 71041449) is 1-[(3S,4R)-4-(3,4-difluorophenyl)-1-(2-methoxyethyl)pyrrolidin-3-yl]-3-[4-methyl-3-(2-methylpyrimidin-5-yl)-1-phenylpyrazol-5-yl]urea.
What is the SMILES notation for US10323022, Example 511?
The canonical SMILES for US10323022, Example 511 is CC1=C(N(N=C1C2=CN=C(N=C2)C)C3=CC=CC=C3)NC(=O)N[C@@H]4CN(C[C@H]4C5=CC(=C(C=C5)F)F)CCOC.
What is the InChIKey of US10323022, Example 511?
The InChIKey is HMZMJVUIFWVPPL-JYFHCDHNSA-N. The full InChI is InChI=1S/C29H31F2N7O2/c1-18-27(21-14-32-19(2)33-15-21)36-38(22-7-5-4-6-8-22)28(18)35-29(39)34-26-17-37(11-12-40-3)16-23(26)20-9-10-24(30)25(31)13-20/h4-10,13-15,23,26H,11-12,16-17H2,1-3H3,(H2,34,35,39)/t23-,26+/m0/s1.
What are the key properties of US10323022, Example 511?
US10323022, Example 511 has a molecular weight of 547.60 g/mol, XLogP of 3.60, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for US10323022, Example 511 is sourced from PubChem (CID 71041449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).