About 5-iodo-1,3-benzoxathiole
5-iodo-1,3-benzoxathiole (PubChem CID 71041502) has the molecular formula C7H5IOS
and a molecular weight of 264.09 g/mol. Its IUPAC name is 5-iodo-1,3-benzoxathiole.
Molecular Properties
| Compound Name | 5-iodo-1,3-benzoxathiole |
| PubChem CID | 71041502 |
| Molecular Formula | C7H5IOS |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 263.91 |
| IUPAC Name | 5-iodo-1,3-benzoxathiole |
| SMILES | Ic1ccc2c(c1)SCO2 |
| InChI | InChI=1S/C7H5IOS/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3H,4H2 |
| InChIKey | KEMKQVHQXXKQPN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-1,3-benzoxathiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-1,3-benzoxathiole?
The IUPAC name of 5-iodo-1,3-benzoxathiole (CID 71041502) is 5-iodo-1,3-benzoxathiole.
What is the SMILES notation for 5-iodo-1,3-benzoxathiole?
The canonical SMILES for 5-iodo-1,3-benzoxathiole is Ic1ccc2c(c1)SCO2.
What is the InChIKey of 5-iodo-1,3-benzoxathiole?
The InChIKey is KEMKQVHQXXKQPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5IOS/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3H,4H2.
What are the key properties of 5-iodo-1,3-benzoxathiole?
5-iodo-1,3-benzoxathiole has a molecular weight of 264.09 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-1,3-benzoxathiole is sourced from PubChem (CID 71041502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).