C24H22ClFN2O2 — CID 71041743
N-[(R)-(4-chlorophenyl)-hydroxymethyl]-2-[1-(4-fluorophenyl)cyclopropyl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 71041743) has the molecular formula C24H22ClFN2O2 and a molecular weight of 424.90 g/mol. Its IUPAC name is N-[(R)-(4-chlorophenyl)-hydroxymethyl]-2-[1-(4-fluorophenyl)cyclopropyl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | N-[(R)-(4-chlorophenyl)-hydroxymethyl]-2-[1-(4-fluorophenyl)cyclopropyl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 71041743 |
| Molecular Formula | C24H22ClFN2O2 |
| Molecular Weight | 424.90 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-[(R)-(4-chlorophenyl)-hydroxymethyl]-2-[1-(4-fluorophenyl)cyclopropyl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(CC1(c2ccc(F)cc2)CC1)N(Cc1ccccn1)[C@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClFN2O2/c25-19-8-4-17(5-9-19)23(30)28(16-21-3-1-2-14-27-21)22(29)15-24(12-13-24)18-6-10-20(26)11-7-18/h1-11,14,23,30H,12-13,15-16H2/t23-/m1/s1 |
| InChIKey | GXLGJSJFOKQGCI-HSZRJFAPSA-N |
| XLogP | 5.02 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.90 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|