C27H23N5O6S3 — CID 71041961
25-methoxy-18-(2-methoxyethoxy)-22,22-dioxo-3,22λ6,30-trithia-6,8,15,23,26-pentazahexacyclo[22.3.1.12,5.110,13.117,21.04,9]hentriaconta-1(28),2(31),4,6,8,10,12,17,19,21(29),24,26-dodecaen-16-one (PubChem CID 71041961) has the molecular formula C27H23N5O6S3 and a molecular weight of 609.71 g/mol. Its IUPAC name is 25-methoxy-18-(2-methoxyethoxy)-22,22-dioxo-3,22λ6,30-trithia-6,8,15,23,26-pentazahexacyclo[22.3.1.12,5.110,13.117,21.04,9]hentriaconta-1(28),2(31),4,6,8,10,12,17,19,21(29),24,26-dodecaen-16-one.
| Compound Name | 25-methoxy-18-(2-methoxyethoxy)-22,22-dioxo-3,22λ6,30-trithia-6,8,15,23,26-pentazahexacyclo[22.3.1.12,5.110,13.117,21.04,9]hentriaconta-1(28),2(31),4,6,8,10,12,17,19,21(29),24,26-dodecaen-16-one |
|---|---|
| PubChem CID | 71041961 |
| Molecular Formula | C27H23N5O6S3 |
| Molecular Weight | 609.71 g/mol |
| Exact Mass | 609.08 |
| IUPAC Name | 25-methoxy-18-(2-methoxyethoxy)-22,22-dioxo-3,22λ6,30-trithia-6,8,15,23,26-pentazahexacyclo[22.3.1.12,5.110,13.117,21.04,9]hentriaconta-1(28),2(31),4,6,8,10,12,17,19,21(29),24,26-dodecaen-16-one |
| SMILES | COCCOc1ccc2cc1C(=O)NCc1ccc(s1)-c1ncnc3cc(sc13)-c1cnc(OC)c(c1)NS2(=O)=O |
| InChI | InChI=1S/C27H23N5O6S3/c1-36-7-8-38-21-5-4-17-10-18(21)26(33)28-13-16-3-6-22(39-16)24-25-19(30-14-31-24)11-23(40-25)15-9-20(32-41(17,34)35)27(37-2)29-12-15/h3-6,9-12,14,32H,7-8,13H2,1-2H3,(H,28,33) |
| InChIKey | BTDLPZVJRSMLGQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.71 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|