C18H9Cl2F3OS — CID 71042647
(Z)-1-(1-benzothiophen-2-yl)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-en-1-one (PubChem CID 71042647) has the molecular formula C18H9Cl2F3OS and a molecular weight of 401.24 g/mol. Its IUPAC name is (Z)-1-(1-benzothiophen-2-yl)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-en-1-one.
| Compound Name | (Z)-1-(1-benzothiophen-2-yl)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-en-1-one |
|---|---|
| PubChem CID | 71042647 |
| Molecular Formula | C18H9Cl2F3OS |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | (Z)-1-(1-benzothiophen-2-yl)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-en-1-one |
| SMILES | O=C(/C=C(/c1cc(Cl)cc(Cl)c1)C(F)(F)F)c1cc2ccccc2s1 |
| InChI | InChI=1S/C18H9Cl2F3OS/c19-12-5-11(6-13(20)8-12)14(18(21,22)23)9-15(24)17-7-10-3-1-2-4-16(10)25-17/h1-9H/b14-9- |
| InChIKey | RKUGYNUPFQYHBQ-ZROIWOOFSA-N |
| XLogP | 7.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|