C27H26N2O4 — CID 71042850
dimethyl 3-benzyl-1,2-diphenyl-2,4-dihydropyrimidine-5,6-dicarboxylate (PubChem CID 71042850) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is dimethyl 3-benzyl-1,2-diphenyl-2,4-dihydropyrimidine-5,6-dicarboxylate.
| Compound Name | dimethyl 3-benzyl-1,2-diphenyl-2,4-dihydropyrimidine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 71042850 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | dimethyl 3-benzyl-1,2-diphenyl-2,4-dihydropyrimidine-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2)C(c2ccccc2)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C27H26N2O4/c1-32-26(30)23-19-28(18-20-12-6-3-7-13-20)25(21-14-8-4-9-15-21)29(24(23)27(31)33-2)22-16-10-5-11-17-22/h3-17,25H,18-19H2,1-2H3 |
| InChIKey | GNUJDWSIFRJLPP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |