C21H21N7O2 — CID 71043024
(E)-2-cyano-N-[(3R)-1-(2-cyanoacetyl)piperidin-3-yl]-3-cyclopropyl-N-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)prop-2-enamide (PubChem CID 71043024) has the molecular formula C21H21N7O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is (E)-2-cyano-N-[(3R)-1-(2-cyanoacetyl)piperidin-3-yl]-3-cyclopropyl-N-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[(3R)-1-(2-cyanoacetyl)piperidin-3-yl]-3-cyclopropyl-N-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 71043024 |
| Molecular Formula | C21H21N7O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (E)-2-cyano-N-[(3R)-1-(2-cyanoacetyl)piperidin-3-yl]-3-cyclopropyl-N-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)prop-2-enamide |
| SMILES | N#CCC(=O)N1CCC[C@@H](N(C(=O)/C(C#N)=C/C2CC2)c2ncnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C21H21N7O2/c22-7-5-18(29)27-9-1-2-16(12-27)28(21(30)15(11-23)10-14-3-4-14)20-17-6-8-24-19(17)25-13-26-20/h6,8,10,13-14,16H,1-5,9,12H2,(H,24,25,26)/b15-10+/t16-/m1/s1 |
| InChIKey | HQQVVUGXHDHKCG-AAGJOFLKSA-N |
| XLogP | 2.06 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|