C33H42N6O6 — CID 71043097
ethyl 3-[2-methyl-3-[[[4-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]phenyl]benzoate (PubChem CID 71043097) has the molecular formula C33H42N6O6 and a molecular weight of 618.74 g/mol. Its IUPAC name is ethyl 3-[2-methyl-3-[[[4-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]phenyl]benzoate.
| Compound Name | ethyl 3-[2-methyl-3-[[[4-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 71043097 |
| Molecular Formula | C33H42N6O6 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | ethyl 3-[2-methyl-3-[[[4-[[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methylamino]-5-nitropyrimidin-2-yl]amino]methyl]phenyl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2cccc(CNc3ncc([N+](=O)[O-])c(NCC4CCC(NC(=O)OC(C)(C)C)CC4)n3)c2C)c1 |
| InChI | InChI=1S/C33H42N6O6/c1-6-44-30(40)24-10-7-9-23(17-24)27-12-8-11-25(21(27)2)19-35-31-36-20-28(39(42)43)29(38-31)34-18-22-13-15-26(16-14-22)37-32(41)45-33(3,4)5/h7-12,17,20,22,26H,6,13-16,18-19H2,1-5H3,(H,37,41)(H2,34,35,36,38) |
| InChIKey | IVPSWZWCNJCICE-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 157.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|