C25H28ClN7O2 — CID 71043187
(E)-2-[(3R)-3-[4-amino-3-(4-chloro-3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile (PubChem CID 71043187) has the molecular formula C25H28ClN7O2 and a molecular weight of 494.00 g/mol. Its IUPAC name is (E)-2-[(3R)-3-[4-amino-3-(4-chloro-3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile.
| Compound Name | (E)-2-[(3R)-3-[4-amino-3-(4-chloro-3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 71043187 |
| Molecular Formula | C25H28ClN7O2 |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | (E)-2-[(3R)-3-[4-amino-3-(4-chloro-3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile |
| SMILES | COc1cc(-c2nn([C@@H]3CCCN(C(=O)/C(C#N)=C/C(C)(C)C)C3)c3ncnc(N)c23)ccc1Cl |
| InChI | InChI=1S/C25H28ClN7O2/c1-25(2,3)11-16(12-27)24(34)32-9-5-6-17(13-32)33-23-20(22(28)29-14-30-23)21(31-33)15-7-8-18(26)19(10-15)35-4/h7-8,10-11,14,17H,5-6,9,13H2,1-4H3,(H2,28,29,30)/b16-11+/t17-/m1/s1 |
| InChIKey | KLPDDMWRDIHFAR-ABPVARSCSA-N |
| XLogP | 4.40 |
| TPSA | 122.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|