C32H32F3N9O2 — CID 71043191
1-[4-[4-amino-1-[(3R)-1-[(E)-2-cyano-4,4-dimethylpent-2-enoyl]piperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 71043191) has the molecular formula C32H32F3N9O2 and a molecular weight of 631.66 g/mol. Its IUPAC name is 1-[4-[4-amino-1-[(3R)-1-[(E)-2-cyano-4,4-dimethylpent-2-enoyl]piperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[4-amino-1-[(3R)-1-[(E)-2-cyano-4,4-dimethylpent-2-enoyl]piperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 71043191 |
| Molecular Formula | C32H32F3N9O2 |
| Molecular Weight | 631.66 g/mol |
| Exact Mass | 631.26 |
| IUPAC Name | 1-[4-[4-amino-1-[(3R)-1-[(E)-2-cyano-4,4-dimethylpent-2-enoyl]piperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CC(C)(C)/C=C(\C#N)C(=O)N1CCC[C@@H](n2nc(-c3ccc(NC(=O)Nc4cccc(C(F)(F)F)c4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C32H32F3N9O2/c1-31(2,3)15-20(16-36)29(45)43-13-5-8-24(17-43)44-28-25(27(37)38-18-39-28)26(42-44)19-9-11-22(12-10-19)40-30(46)41-23-7-4-6-21(14-23)32(33,34)35/h4,6-7,9-12,14-15,18,24H,5,8,13,17H2,1-3H3,(H2,37,38,39)(H2,40,41,46)/b20-15+/t24-/m1/s1 |
| InChIKey | OGFKQZSNHMQBEP-NAENUDGNSA-N |
| XLogP | 6.40 |
| TPSA | 154.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.66 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|