C20H22F3NO4 — CID 71043346
(1S,2R,4S,5R,8R,12S)-4-ethyl-2-hydroxy-7-[4-methyl-3-(trifluoromethyl)phenyl]-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-6-one (PubChem CID 71043346) has the molecular formula C20H22F3NO4 and a molecular weight of 397.39 g/mol. Its IUPAC name is (1S,2R,4S,5R,8R,12S)-4-ethyl-2-hydroxy-7-[4-methyl-3-(trifluoromethyl)phenyl]-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-6-one.
| Compound Name | (1S,2R,4S,5R,8R,12S)-4-ethyl-2-hydroxy-7-[4-methyl-3-(trifluoromethyl)phenyl]-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-6-one |
|---|---|
| PubChem CID | 71043346 |
| Molecular Formula | C20H22F3NO4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (1S,2R,4S,5R,8R,12S)-4-ethyl-2-hydroxy-7-[4-methyl-3-(trifluoromethyl)phenyl]-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-6-one |
| SMILES | CC[C@]12C[C@@H](O)[C@@]3(CCO[C@@H]4[C@H]3[C@H]1C(=O)N4c1ccc(C)c(C(F)(F)F)c1)O2 |
| InChI | InChI=1S/C20H22F3NO4/c1-3-18-9-13(25)19(28-18)6-7-27-17-15(19)14(18)16(26)24(17)11-5-4-10(2)12(8-11)20(21,22)23/h4-5,8,13-15,17,25H,3,6-7,9H2,1-2H3/t13-,14+,15-,17-,18+,19-/m1/s1 |
| InChIKey | BAHLJSGGHHBQGO-NUTUMTGBSA-N |
| XLogP | 3.02 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |