C26H45N — CID 71043479
3-[(Z)-dodec-7-en-3-yl]-2-(2-methylpentan-3-yl)-2,3,6,7-tetrahydro-1H-indole (PubChem CID 71043479) has the molecular formula C26H45N and a molecular weight of 371.65 g/mol. Its IUPAC name is 3-[(Z)-dodec-7-en-3-yl]-2-(2-methylpentan-3-yl)-2,3,6,7-tetrahydro-1H-indole.
| Compound Name | 3-[(Z)-dodec-7-en-3-yl]-2-(2-methylpentan-3-yl)-2,3,6,7-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 71043479 |
| Molecular Formula | C26H45N |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 371.36 |
| IUPAC Name | 3-[(Z)-dodec-7-en-3-yl]-2-(2-methylpentan-3-yl)-2,3,6,7-tetrahydro-1H-indole |
| SMILES | CCCC/C=C\CCCC(CC)C1C2=C(CCC=C2)NC1C(CC)C(C)C |
| InChI | InChI=1S/C26H45N/c1-6-9-10-11-12-13-14-17-21(7-2)25-23-18-15-16-19-24(23)27-26(25)22(8-3)20(4)5/h11-12,15,18,20-22,25-27H,6-10,13-14,16-17,19H2,1-5H3/b12-11- |
| InChIKey | JOKUBUAGKKRPQI-QXMHVHEDSA-N |
| XLogP | 7.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|